C12H14F3NO — CID 107502589
1-(2,6-dimethyl-4-pyridinyl)-5,5,5-trifluoropentan-1-one (PubChem CID 107502589) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-pyridinyl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(2,6-dimethyl-4-pyridinyl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 107502589 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(2,6-dimethyl-4-pyridinyl)-5,5,5-trifluoropentan-1-one |
| SMILES | Cc1cc(C(=O)CCCC(F)(F)F)cc(C)n1 |
| InChI | InChI=1S/C12H14F3NO/c1-8-6-10(7-9(2)16-8)11(17)4-3-5-12(13,14)15/h6-7H,3-5H2,1-2H3 |
| InChIKey | QEDPDBYEYPZNQB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |