C16H22O3 — CID 2757286
1-(4-tert-butylphenyl)-3-(1,3-dioxolan-2-yl)propan-1-one (PubChem CID 2757286) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(1,3-dioxolan-2-yl)propan-1-one.
| Compound Name | 1-(4-tert-butylphenyl)-3-(1,3-dioxolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 2757286 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(1,3-dioxolan-2-yl)propan-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)CCC2OCCO2)cc1 |
| InChI | InChI=1S/C16H22O3/c1-16(2,3)13-6-4-12(5-7-13)14(17)8-9-15-18-10-11-19-15/h4-7,15H,8-11H2,1-3H3 |
| InChIKey | SPKXAMCESUCLEM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |