C32H38O2 — CID 118329134
1-(4-tert-butylphenyl)-3-[4-[hydroxy(diphenyl)methyl]cyclohexyl]propan-1-one (PubChem CID 118329134) has the molecular formula C32H38O2 and a molecular weight of 454.65 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[4-[hydroxy(diphenyl)methyl]cyclohexyl]propan-1-one.
| Compound Name | 1-(4-tert-butylphenyl)-3-[4-[hydroxy(diphenyl)methyl]cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 118329134 |
| Molecular Formula | C32H38O2 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[4-[hydroxy(diphenyl)methyl]cyclohexyl]propan-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)CCC2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H38O2/c1-31(2,3)26-21-17-25(18-22-26)30(33)23-16-24-14-19-29(20-15-24)32(34,27-10-6-4-7-11-27)28-12-8-5-9-13-28/h4-13,17-18,21-22,24,29,34H,14-16,19-20,23H2,1-3H3 |
| InChIKey | WRQRIJQZEHZICG-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |