C21H23BO5 — CID 159235120
(2,6-dimethylphenyl)methyl (2R)-4-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-methyl-4-oxobutanoate (PubChem CID 159235120) has the molecular formula C21H23BO5 and a molecular weight of 366.22 g/mol. Its IUPAC name is (2,6-dimethylphenyl)methyl (2R)-4-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-methyl-4-oxobutanoate.
| Compound Name | (2,6-dimethylphenyl)methyl (2R)-4-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 159235120 |
| Molecular Formula | C21H23BO5 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (2,6-dimethylphenyl)methyl (2R)-4-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-methyl-4-oxobutanoate |
| SMILES | Cc1cccc(C)c1COC(=O)[C@H](C)CC(=O)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C21H23BO5/c1-13-5-4-6-14(2)18(13)12-26-21(24)15(3)9-20(23)16-7-8-17-11-27-22(25)19(17)10-16/h4-8,10,15,25H,9,11-12H2,1-3H3/t15-/m1/s1 |
| InChIKey | GNZKFBANECDWNS-OAHLLOKOSA-N |
| XLogP | 2.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|