C24H33N5O4 — CID 71817809
methyl (2S)-6-amino-2-[[4-amino-3-[[(2S)-2-amino-4-phenylbutanoyl]amino]benzoyl]amino]hexanoate (PubChem CID 71817809) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[[4-amino-3-[[(2S)-2-amino-4-phenylbutanoyl]amino]benzoyl]amino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[[4-amino-3-[[(2S)-2-amino-4-phenylbutanoyl]amino]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 71817809 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | methyl (2S)-6-amino-2-[[4-amino-3-[[(2S)-2-amino-4-phenylbutanoyl]amino]benzoyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCN)NC(=O)c1ccc(N)c(NC(=O)[C@@H](N)CCc2ccccc2)c1 |
| InChI | InChI=1S/C24H33N5O4/c1-33-24(32)20(9-5-6-14-25)28-22(30)17-11-13-18(26)21(15-17)29-23(31)19(27)12-10-16-7-3-2-4-8-16/h2-4,7-8,11,13,15,19-20H,5-6,9-10,12,14,25-27H2,1H3,(H,28,30)(H,29,31)/t19-,20-/m0/s1 |
| InChIKey | PLKKJOBNGCNHOY-PMACEKPBSA-N |
| XLogP | 1.57 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|