C24H33N5O5 — CID 118734174
methyl (2S)-6-amino-2-[[4-amino-3-[[(2S)-2-amino-3-phenylmethoxypropanoyl]amino]benzoyl]amino]hexanoate (PubChem CID 118734174) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[[4-amino-3-[[(2S)-2-amino-3-phenylmethoxypropanoyl]amino]benzoyl]amino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[[4-amino-3-[[(2S)-2-amino-3-phenylmethoxypropanoyl]amino]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 118734174 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | methyl (2S)-6-amino-2-[[4-amino-3-[[(2S)-2-amino-3-phenylmethoxypropanoyl]amino]benzoyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCN)NC(=O)c1ccc(N)c(NC(=O)[C@@H](N)COCc2ccccc2)c1 |
| InChI | InChI=1S/C24H33N5O5/c1-33-24(32)20(9-5-6-12-25)28-22(30)17-10-11-18(26)21(13-17)29-23(31)19(27)15-34-14-16-7-3-2-4-8-16/h2-4,7-8,10-11,13,19-20H,5-6,9,12,14-15,25-27H2,1H3,(H,28,30)(H,29,31)/t19-,20-/m0/s1 |
| InChIKey | ZMPGASXGOYLYDQ-PMACEKPBSA-N |
| XLogP | 1.15 |
| TPSA | 171.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|