C15H14BNO4S — CID 143895324
methyl 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzoate (PubChem CID 143895324) has the molecular formula C15H14BNO4S and a molecular weight of 315.16 g/mol. Its IUPAC name is methyl 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzoate.
| Compound Name | methyl 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzoate |
|---|---|
| PubChem CID | 143895324 |
| Molecular Formula | C15H14BNO4S |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | methyl 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzoate |
| SMILES | COC(=O)c1ccccc1SNc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C15H14BNO4S/c1-20-15(18)12-4-2-3-5-14(12)22-17-11-7-6-10-9-21-16(19)13(10)8-11/h2-8,17,19H,9H2,1H3 |
| InChIKey | MUBRODMXEOKSHE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|