C14H10BNO3 — CID 25010447
4-[(1-hydroxy-3H-2,1-benzoxaborol-4-yl)oxy]benzonitrile (PubChem CID 25010447) has the molecular formula C14H10BNO3 and a molecular weight of 251.05 g/mol. Its IUPAC name is 4-[(1-hydroxy-3H-2,1-benzoxaborol-4-yl)oxy]benzonitrile.
| Compound Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-4-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 25010447 |
| Molecular Formula | C14H10BNO3 |
| Molecular Weight | 251.05 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-4-yl)oxy]benzonitrile |
| SMILES | N#Cc1ccc(Oc2cccc3c2COB3O)cc1 |
| InChI | InChI=1S/C14H10BNO3/c16-8-10-4-6-11(7-5-10)19-14-3-1-2-13-12(14)9-18-15(13)17/h1-7,17H,9H2 |
| InChIKey | JHCANABFXFFJEV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.05 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|