C14H13BO3 — CID 70914453
1-hydroxy-6-(4-methylphenoxy)-3H-2,1-benzoxaborole (PubChem CID 70914453) has the molecular formula C14H13BO3 and a molecular weight of 240.07 g/mol. Its IUPAC name is 1-hydroxy-6-(4-methylphenoxy)-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-6-(4-methylphenoxy)-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 70914453 |
| Molecular Formula | C14H13BO3 |
| Molecular Weight | 240.07 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-hydroxy-6-(4-methylphenoxy)-3H-2,1-benzoxaborole |
| SMILES | Cc1ccc(Oc2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C14H13BO3/c1-10-2-5-12(6-3-10)18-13-7-4-11-9-17-15(16)14(11)8-13/h2-8,16H,9H2,1H3 |
| InChIKey | MXLYACSUYXSSPY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.07 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|