C15H14BNO4 — CID 139270772
(4-methylphenyl) N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate (PubChem CID 139270772) has the molecular formula C15H14BNO4 and a molecular weight of 283.09 g/mol. Its IUPAC name is (4-methylphenyl) N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate.
| Compound Name | (4-methylphenyl) N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
|---|---|
| PubChem CID | 139270772 |
| Molecular Formula | C15H14BNO4 |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (4-methylphenyl) N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
| SMILES | Cc1ccc(OC(=O)Nc2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C15H14BNO4/c1-10-2-6-13(7-3-10)21-15(18)17-12-5-4-11-9-20-16(19)14(11)8-12/h2-8,19H,9H2,1H3,(H,17,18) |
| InChIKey | PCGKOFLZSDBDCU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|