C10H11NO2 — CID 58999561
1-isocyano-4,5-dimethoxy-2-methylbenzene (PubChem CID 58999561) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 1-isocyano-4,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-isocyano-4,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 58999561 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 1-isocyano-4,5-dimethoxy-2-methylbenzene |
| SMILES | [C-]#[N+]c1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C10H11NO2/c1-7-5-9(12-3)10(13-4)6-8(7)11-2/h5-6H,1,3-4H3 |
| InChIKey | WFCRKNRISWBEON-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|