C9H12O2S — CID 43626828
4,5-dimethoxy-2-methylbenzenethiol (PubChem CID 43626828) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methylbenzenethiol.
| Compound Name | 4,5-dimethoxy-2-methylbenzenethiol |
|---|---|
| PubChem CID | 43626828 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 4,5-dimethoxy-2-methylbenzenethiol |
| SMILES | COc1cc(C)c(S)cc1OC |
| InChI | InChI=1S/C9H12O2S/c1-6-4-7(10-2)8(11-3)5-9(6)12/h4-5,12H,1-3H3 |
| InChIKey | HAZVSNQMNFGKEJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|