C14H19NO2S — CID 142838622
4-(2-methoxy-5-methyl-4-sulfanylanilino)-3-methylpent-4-en-2-one (PubChem CID 142838622) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 4-(2-methoxy-5-methyl-4-sulfanylanilino)-3-methylpent-4-en-2-one.
| Compound Name | 4-(2-methoxy-5-methyl-4-sulfanylanilino)-3-methylpent-4-en-2-one |
|---|---|
| PubChem CID | 142838622 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-(2-methoxy-5-methyl-4-sulfanylanilino)-3-methylpent-4-en-2-one |
| SMILES | C=C(Nc1cc(C)c(S)cc1OC)C(C)C(C)=O |
| InChI | InChI=1S/C14H19NO2S/c1-8-6-12(13(17-5)7-14(8)18)15-10(3)9(2)11(4)16/h6-7,9,15,18H,3H2,1-2,4-5H3 |
| InChIKey | GWEJBMWIMHZMLU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|