C16H25NO6S — CID 142838577
ethane;5-methoxy-2-methyl-4-[(2-methyl-3-oxopentanoyl)amino]benzenesulfonic acid (PubChem CID 142838577) has the molecular formula C16H25NO6S and a molecular weight of 359.44 g/mol. Its IUPAC name is ethane;5-methoxy-2-methyl-4-[(2-methyl-3-oxopentanoyl)amino]benzenesulfonic acid.
| Compound Name | ethane;5-methoxy-2-methyl-4-[(2-methyl-3-oxopentanoyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 142838577 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethane;5-methoxy-2-methyl-4-[(2-methyl-3-oxopentanoyl)amino]benzenesulfonic acid |
| SMILES | CC.CCC(=O)C(C)C(=O)Nc1cc(C)c(S(=O)(=O)O)cc1OC |
| InChI | InChI=1S/C14H19NO6S.C2H6/c1-5-11(16)9(3)14(17)15-10-6-8(2)13(22(18,19)20)7-12(10)21-4;1-2/h6-7,9H,5H2,1-4H3,(H,15,17)(H,18,19,20);1-2H3 |
| InChIKey | LVUXOKDWEYMVIS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|