C12H18N2O4S — CID 162727666
N-[4-(dimethylsulfamoyl)-2-methoxy-5-methylphenyl]acetamide (PubChem CID 162727666) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)-2-methoxy-5-methylphenyl]acetamide.
| Compound Name | N-[4-(dimethylsulfamoyl)-2-methoxy-5-methylphenyl]acetamide |
|---|---|
| PubChem CID | 162727666 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)-2-methoxy-5-methylphenyl]acetamide |
| SMILES | COc1cc(S(=O)(=O)N(C)C)c(C)cc1NC(C)=O |
| InChI | InChI=1S/C12H18N2O4S/c1-8-6-10(13-9(2)15)11(18-5)7-12(8)19(16,17)14(3)4/h6-7H,1-5H3,(H,13,15) |
| InChIKey | USHIRZSRRLAWOW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |