C10H14ClNO3S — CID 934502
5-chloro-2-methoxy-N,N,4-trimethylbenzenesulfonamide (PubChem CID 934502) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N,N,4-trimethylbenzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N,N,4-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 934502 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 5-chloro-2-methoxy-N,N,4-trimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(Cl)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H14ClNO3S/c1-7-5-9(15-4)10(6-8(7)11)16(13,14)12(2)3/h5-6H,1-4H3 |
| InChIKey | CYAIIRMCYQHMNT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |