C14H18ClNO3S — CID 7333036
5-chloro-2-methoxy-4-methyl-N-[(3R)-3-methylpent-1-yn-3-yl]benzenesulfonamide (PubChem CID 7333036) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-methyl-N-[(3R)-3-methylpent-1-yn-3-yl]benzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-4-methyl-N-[(3R)-3-methylpent-1-yn-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 7333036 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-chloro-2-methoxy-4-methyl-N-[(3R)-3-methylpent-1-yn-3-yl]benzenesulfonamide |
| SMILES | C#C[C@@](C)(CC)NS(=O)(=O)c1cc(Cl)c(C)cc1OC |
| InChI | InChI=1S/C14H18ClNO3S/c1-6-14(4,7-2)16-20(17,18)13-9-11(15)10(3)8-12(13)19-5/h1,8-9,16H,7H2,2-5H3/t14-/m0/s1 |
| InChIKey | AZJYGVSKLKRJIA-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|