C18H20N4O9S2 — CID 54063207
4-[[2-[(5-amino-2-sulfophenyl)diazenyl]-3-oxobutanoyl]amino]-5-methoxy-2-methylbenzenesulfonic acid (PubChem CID 54063207) has the molecular formula C18H20N4O9S2 and a molecular weight of 500.51 g/mol. Its IUPAC name is 4-[[2-[(5-amino-2-sulfophenyl)diazenyl]-3-oxobutanoyl]amino]-5-methoxy-2-methylbenzenesulfonic acid.
| Compound Name | 4-[[2-[(5-amino-2-sulfophenyl)diazenyl]-3-oxobutanoyl]amino]-5-methoxy-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 54063207 |
| Molecular Formula | C18H20N4O9S2 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 4-[[2-[(5-amino-2-sulfophenyl)diazenyl]-3-oxobutanoyl]amino]-5-methoxy-2-methylbenzenesulfonic acid |
| SMILES | COc1cc(S(=O)(=O)O)c(C)cc1NC(=O)C(/N=N/c1cc(N)ccc1S(=O)(=O)O)C(C)=O |
| InChI | InChI=1S/C18H20N4O9S2/c1-9-6-12(14(31-3)8-16(9)33(28,29)30)20-18(24)17(10(2)23)22-21-13-7-11(19)4-5-15(13)32(25,26)27/h4-8,17H,19H2,1-3H3,(H,20,24)(H,25,26,27)(H,28,29,30)/b22-21+ |
| InChIKey | MBERVQAHZKOSRD-QURGRASLSA-N |
| XLogP | 1.76 |
| TPSA | 214.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|