C34H32N6NaO10S2 — CID 156595455
[1,1'-Biphenyl]-2,2'-disulfonic acid,5,5'-dimethyl-4,4'-bis[[2-oxo-1-[(phenylamino)carbonyl]propyl]azo]-,disodium salt (PubChem CID 156595455) has the molecular formula C34H32N6NaO10S2 and a molecular weight of 771.79 g/mol.
| Compound Name | [1,1'-Biphenyl]-2,2'-disulfonic acid,5,5'-dimethyl-4,4'-bis[[2-oxo-1-[(phenylamino)carbonyl]propyl]azo]-,disodium salt |
|---|---|
| PubChem CID | 156595455 |
| Molecular Formula | C34H32N6NaO10S2 |
| Molecular Weight | 771.79 g/mol |
| Exact Mass | 771.15 |
| IUPAC Name | — |
| SMILES | CC(=O)C(/N=N/c1cc(S(=O)(=O)O)c(-c2cc(C)c(/N=N/C(C(C)=O)C(=O)Nc3ccccc3)cc2S(=O)(=O)O)cc1C)C(=O)Nc1ccccc1.[Na] |
| InChI | InChI=1S/C34H32N6O10S2.Na/c1-19-15-25(29(51(45,46)47)17-27(19)37-39-31(21(3)41)33(43)35-23-11-7-5-8-12-23)26-16-20(2)28(18-30(26)52(48,49)50)38-40-32(22(4)42)34(44)36-24-13-9-6-10-14-24;/h5-18,31-32H,1-4H3,(H,35,43)(H,36,44)(H,45,46,47)(H,48,49,50);/b39-37+,40-38+; |
| InChIKey | MUHUDDOYYNZYPF-IJKDMPGWSA-N |
| XLogP | 5.44 |
| TPSA | 250.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.79 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|