C16H14N4O4 — CID 98047866
(2R)-2-[(2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide (PubChem CID 98047866) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is (2R)-2-[(2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide.
| Compound Name | (2R)-2-[(2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 98047866 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (2R)-2-[(2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide |
| SMILES | CC(=O)[C@@H](/N=N/c1ccccc1[N+](=O)[O-])C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H14N4O4/c1-11(21)15(16(22)17-12-7-3-2-4-8-12)19-18-13-9-5-6-10-14(13)20(23)24/h2-10,15H,1H3,(H,17,22)/b19-18+/t15-/m1/s1 |
| InChIKey | FCUWHABSNJYYDW-AMGRQBIBSA-N |
| XLogP | 3.27 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|