C17H16N4O7S — CID 21115874
4-[[1-(2-methylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-nitrobenzenesulfonic acid (PubChem CID 21115874) has the molecular formula C17H16N4O7S and a molecular weight of 420.40 g/mol. Its IUPAC name is 4-[[1-(2-methylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-nitrobenzenesulfonic acid.
| Compound Name | 4-[[1-(2-methylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 21115874 |
| Molecular Formula | C17H16N4O7S |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 4-[[1-(2-methylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-nitrobenzenesulfonic acid |
| SMILES | CC(=O)C(/N=N/c1ccc(S(=O)(=O)O)cc1[N+](=O)[O-])C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C17H16N4O7S/c1-10-5-3-4-6-13(10)18-17(23)16(11(2)22)20-19-14-8-7-12(29(26,27)28)9-15(14)21(24)25/h3-9,16H,1-2H3,(H,18,23)(H,26,27,28)/b20-19+ |
| InChIKey | SNFDYKQTKIEAFN-FMQUCBEESA-N |
| XLogP | 2.83 |
| TPSA | 168.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|