C17H16N4O8S — CID 58587331
N-(2-methoxyphenyl)-2-[[2-nitro-4-(trioxidanylsulfanyl)phenyl]diazenyl]-3-oxobutanamide (PubChem CID 58587331) has the molecular formula C17H16N4O8S and a molecular weight of 436.40 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[[2-nitro-4-(trioxidanylsulfanyl)phenyl]diazenyl]-3-oxobutanamide.
| Compound Name | N-(2-methoxyphenyl)-2-[[2-nitro-4-(trioxidanylsulfanyl)phenyl]diazenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 58587331 |
| Molecular Formula | C17H16N4O8S |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[[2-nitro-4-(trioxidanylsulfanyl)phenyl]diazenyl]-3-oxobutanamide |
| SMILES | COc1ccccc1NC(=O)C(/N=N/c1ccc(SOOO)cc1[N+](=O)[O-])C(C)=O |
| InChI | InChI=1S/C17H16N4O8S/c1-10(22)16(17(23)18-13-5-3-4-6-15(13)27-2)20-19-12-8-7-11(30-29-28-26)9-14(12)21(24)25/h3-9,16,26H,1-2H3,(H,18,23)/b20-19+ |
| InChIKey | GBWYPBGAMZOFTE-FMQUCBEESA-N |
| XLogP | 3.71 |
| TPSA | 161.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|