C28H27N3O6 — CID 91183875
(3-ethenylphenyl)methyl 3-methoxy-4-[[1-(2-methoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]benzoate (PubChem CID 91183875) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is (3-ethenylphenyl)methyl 3-methoxy-4-[[1-(2-methoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]benzoate.
| Compound Name | (3-ethenylphenyl)methyl 3-methoxy-4-[[1-(2-methoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 91183875 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (3-ethenylphenyl)methyl 3-methoxy-4-[[1-(2-methoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]benzoate |
| SMILES | C=Cc1cccc(COC(=O)c2ccc(/N=N/C(C(C)=O)C(=O)Nc3ccccc3OC)c(OC)c2)c1 |
| InChI | InChI=1S/C28H27N3O6/c1-5-19-9-8-10-20(15-19)17-37-28(34)21-13-14-23(25(16-21)36-4)30-31-26(18(2)32)27(33)29-22-11-6-7-12-24(22)35-3/h5-16,26H,1,17H2,2-4H3,(H,29,33)/b31-30+ |
| InChIKey | PAECTVJVSGTQAI-NVQSTNCTSA-N |
| XLogP | 5.38 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|