C22H23N3O8 — CID 91416009
dimethyl 5-[[1-[2-(2-hydroxyethoxy)anilino]-1,3-dioxobutan-2-yl]diazenyl]benzene-1,3-dicarboxylate (PubChem CID 91416009) has the molecular formula C22H23N3O8 and a molecular weight of 457.44 g/mol. Its IUPAC name is dimethyl 5-[[1-[2-(2-hydroxyethoxy)anilino]-1,3-dioxobutan-2-yl]diazenyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[1-[2-(2-hydroxyethoxy)anilino]-1,3-dioxobutan-2-yl]diazenyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91416009 |
| Molecular Formula | C22H23N3O8 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | dimethyl 5-[[1-[2-(2-hydroxyethoxy)anilino]-1,3-dioxobutan-2-yl]diazenyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=N/C(C(C)=O)C(=O)Nc2ccccc2OCCO)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H23N3O8/c1-13(27)19(20(28)23-17-6-4-5-7-18(17)33-9-8-26)25-24-16-11-14(21(29)31-2)10-15(12-16)22(30)32-3/h4-7,10-12,19,26H,8-9H2,1-3H3,(H,23,28)/b25-24+ |
| InChIKey | SBDCSSFTCXRAOP-OCOZRVBESA-N |
| XLogP | 2.31 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|