C34H50ClN7O6 — CID 58527857
5-[[1-[4-chloro-5-(hydroxymethyl)-2-methoxyanilino]-1,3-dioxobutan-2-yl]diazenyl]-1-N,3-N-bis[3-(diethylamino)propyl]benzene-1,3-dicarboxamide (PubChem CID 58527857) has the molecular formula C34H50ClN7O6 and a molecular weight of 688.27 g/mol. Its IUPAC name is 5-[[1-[4-chloro-5-(hydroxymethyl)-2-methoxyanilino]-1,3-dioxobutan-2-yl]diazenyl]-1-N,3-N-bis[3-(diethylamino)propyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-[[1-[4-chloro-5-(hydroxymethyl)-2-methoxyanilino]-1,3-dioxobutan-2-yl]diazenyl]-1-N,3-N-bis[3-(diethylamino)propyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58527857 |
| Molecular Formula | C34H50ClN7O6 |
| Molecular Weight | 688.27 g/mol |
| Exact Mass | 687.35 |
| IUPAC Name | 5-[[1-[4-chloro-5-(hydroxymethyl)-2-methoxyanilino]-1,3-dioxobutan-2-yl]diazenyl]-1-N,3-N-bis[3-(diethylamino)propyl]benzene-1,3-dicarboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1cc(/N=N/C(C(C)=O)C(=O)Nc2cc(CO)c(Cl)cc2OC)cc(C(=O)NCCCN(CC)CC)c1 |
| InChI | InChI=1S/C34H50ClN7O6/c1-7-41(8-2)15-11-13-36-32(45)24-17-25(33(46)37-14-12-16-42(9-3)10-4)19-27(18-24)39-40-31(23(5)44)34(47)38-29-20-26(22-43)28(35)21-30(29)48-6/h17-21,31,43H,7-16,22H2,1-6H3,(H,36,45)(H,37,46)(H,38,47)/b40-39+ |
| InChIKey | NJRRQFGWMVJWFM-XQQUEIPISA-N |
| XLogP | 4.44 |
| TPSA | 165.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|