C23H25N3O8 — CID 88559378
dimethyl 5-[[(Z)-[1-[2-(2-hydroxyethoxy)anilino]-1,3-dioxobutan-2-ylidene]amino]-methylamino]benzene-1,3-dicarboxylate (PubChem CID 88559378) has the molecular formula C23H25N3O8 and a molecular weight of 471.47 g/mol. Its IUPAC name is dimethyl 5-[[(Z)-[1-[2-(2-hydroxyethoxy)anilino]-1,3-dioxobutan-2-ylidene]amino]-methylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(Z)-[1-[2-(2-hydroxyethoxy)anilino]-1,3-dioxobutan-2-ylidene]amino]-methylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 88559378 |
| Molecular Formula | C23H25N3O8 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | dimethyl 5-[[(Z)-[1-[2-(2-hydroxyethoxy)anilino]-1,3-dioxobutan-2-ylidene]amino]-methylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(N(C)/N=C(/C(C)=O)C(=O)Nc2ccccc2OCCO)c1 |
| InChI | InChI=1S/C23H25N3O8/c1-14(28)20(21(29)24-18-7-5-6-8-19(18)34-10-9-27)25-26(2)17-12-15(22(30)32-3)11-16(13-17)23(31)33-4/h5-8,11-13,27H,9-10H2,1-4H3,(H,24,29)/b25-20- |
| InChIKey | WRLDQCOENPWVKC-QQTULTPQSA-N |
| XLogP | 1.65 |
| TPSA | 143.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|