C21H24N2O5 — CID 113131429
methyl 3-[acetyl-[3-(2-ethoxyanilino)-3-oxopropyl]amino]benzoate (PubChem CID 113131429) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 3-[acetyl-[3-(2-ethoxyanilino)-3-oxopropyl]amino]benzoate.
| Compound Name | methyl 3-[acetyl-[3-(2-ethoxyanilino)-3-oxopropyl]amino]benzoate |
|---|---|
| PubChem CID | 113131429 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl 3-[acetyl-[3-(2-ethoxyanilino)-3-oxopropyl]amino]benzoate |
| SMILES | CCOc1ccccc1NC(=O)CCN(C(C)=O)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-4-28-19-11-6-5-10-18(19)22-20(25)12-13-23(15(2)24)17-9-7-8-16(14-17)21(26)27-3/h5-11,14H,4,12-13H2,1-3H3,(H,22,25) |
| InChIKey | UXGSGUSQQDEILN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |