C22H23N3O8 — CID 152774541
dimethyl 2-[[3-hydroxy-1-[2-(2-hydroxyethoxy)anilino]-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-dicarboxylate (PubChem CID 152774541) has the molecular formula C22H23N3O8 and a molecular weight of 457.44 g/mol. Its IUPAC name is dimethyl 2-[[3-hydroxy-1-[2-(2-hydroxyethoxy)anilino]-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[3-hydroxy-1-[2-(2-hydroxyethoxy)anilino]-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 152774541 |
| Molecular Formula | C22H23N3O8 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | dimethyl 2-[[3-hydroxy-1-[2-(2-hydroxyethoxy)anilino]-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(/N=N/C(C(=O)Nc2ccccc2OCCO)=C(C)O)c1 |
| InChI | InChI=1S/C22H23N3O8/c1-13(27)19(20(28)23-16-6-4-5-7-18(16)33-11-10-26)25-24-17-12-14(21(29)31-2)8-9-15(17)22(30)32-3/h4-9,12,26-27H,10-11H2,1-3H3,(H,23,28)/b19-13?,25-24+ |
| InChIKey | IPCRDXJFWDZDMN-ACLDLCKGSA-N |
| XLogP | 3.14 |
| TPSA | 156.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|