C30H27N3O8 — CID 149141514
dimethyl 2-[[1-[3-[(4-ethenylphenyl)methoxycarbonyl]anilino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-dicarboxylate (PubChem CID 149141514) has the molecular formula C30H27N3O8 and a molecular weight of 557.56 g/mol. Its IUPAC name is dimethyl 2-[[1-[3-[(4-ethenylphenyl)methoxycarbonyl]anilino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[1-[3-[(4-ethenylphenyl)methoxycarbonyl]anilino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 149141514 |
| Molecular Formula | C30H27N3O8 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | dimethyl 2-[[1-[3-[(4-ethenylphenyl)methoxycarbonyl]anilino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-dicarboxylate |
| SMILES | C=Cc1ccc(COC(=O)c2cccc(NC(=O)C(/N=N/c3cc(C(=O)OC)ccc3C(=O)OC)=C(C)O)c2)cc1 |
| InChI | InChI=1S/C30H27N3O8/c1-5-19-9-11-20(12-10-19)17-41-29(37)21-7-6-8-23(15-21)31-27(35)26(18(2)34)33-32-25-16-22(28(36)39-3)13-14-24(25)30(38)40-4/h5-16,34H,1,17H2,2-4H3,(H,31,35)/b26-18?,33-32+ |
| InChIKey | VVKBBWWGXIPGQV-JQPUNIGVSA-N |
| XLogP | 5.77 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|