C18H16N8O3S — CID 58120809
2-[[4-cyano-1-(3-methyl-1,2,4-thiadiazol-5-yl)pyrazol-5-yl]diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide (PubChem CID 58120809) has the molecular formula C18H16N8O3S and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-[[4-cyano-1-(3-methyl-1,2,4-thiadiazol-5-yl)pyrazol-5-yl]diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide.
| Compound Name | 2-[[4-cyano-1-(3-methyl-1,2,4-thiadiazol-5-yl)pyrazol-5-yl]diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 58120809 |
| Molecular Formula | C18H16N8O3S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-[[4-cyano-1-(3-methyl-1,2,4-thiadiazol-5-yl)pyrazol-5-yl]diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| SMILES | COc1ccccc1NC(=O)C(/N=N/c1c(C#N)cnn1-c1nc(C)ns1)C(C)=O |
| InChI | InChI=1S/C18H16N8O3S/c1-10(27)15(17(28)22-13-6-4-5-7-14(13)29-3)23-24-16-12(8-19)9-20-26(16)18-21-11(2)25-30-18/h4-7,9,15H,1-3H3,(H,22,28)/b24-23+ |
| InChIKey | MWIUJDPEGZARGS-WCWDXBQESA-N |
| XLogP | 2.59 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|