C19H16N8O2 — CID 58120891
2-[(4-cyano-1-pyrimidin-2-ylpyrazol-5-yl)diazenyl]-N-(2-methylphenyl)-3-oxobutanamide (PubChem CID 58120891) has the molecular formula C19H16N8O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is 2-[(4-cyano-1-pyrimidin-2-ylpyrazol-5-yl)diazenyl]-N-(2-methylphenyl)-3-oxobutanamide.
| Compound Name | 2-[(4-cyano-1-pyrimidin-2-ylpyrazol-5-yl)diazenyl]-N-(2-methylphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 58120891 |
| Molecular Formula | C19H16N8O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[(4-cyano-1-pyrimidin-2-ylpyrazol-5-yl)diazenyl]-N-(2-methylphenyl)-3-oxobutanamide |
| SMILES | CC(=O)C(/N=N/c1c(C#N)cnn1-c1ncccn1)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C19H16N8O2/c1-12-6-3-4-7-15(12)24-18(29)16(13(2)28)25-26-17-14(10-20)11-23-27(17)19-21-8-5-9-22-19/h3-9,11,16H,1-2H3,(H,24,29)/b26-25+ |
| InChIKey | QMSVKXBSLPCUSK-OCEACIFDSA-N |
| XLogP | 2.52 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|