C29H29N7O8 — CID 54209235
2-[(2-methoxy-4-methylphenyl)diazenyl]-N-[4-[[2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanoyl]amino]phenyl]-3-oxobutanamide (PubChem CID 54209235) has the molecular formula C29H29N7O8 and a molecular weight of 603.59 g/mol. Its IUPAC name is 2-[(2-methoxy-4-methylphenyl)diazenyl]-N-[4-[[2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanoyl]amino]phenyl]-3-oxobutanamide.
| Compound Name | 2-[(2-methoxy-4-methylphenyl)diazenyl]-N-[4-[[2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanoyl]amino]phenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 54209235 |
| Molecular Formula | C29H29N7O8 |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | 2-[(2-methoxy-4-methylphenyl)diazenyl]-N-[4-[[2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanoyl]amino]phenyl]-3-oxobutanamide |
| SMILES | COc1cc(C)ccc1/N=N/C(C(C)=O)C(=O)Nc1ccc(NC(=O)C(/N=N/c2ccc([N+](=O)[O-])cc2OC)C(C)=O)cc1 |
| InChI | InChI=1S/C29H29N7O8/c1-16-6-12-22(24(14-16)43-4)32-34-26(17(2)37)28(39)30-19-7-9-20(10-8-19)31-29(40)27(18(3)38)35-33-23-13-11-21(36(41)42)15-25(23)44-5/h6-15,26-27H,1-5H3,(H,30,39)(H,31,40)/b34-32+,35-33+ |
| InChIKey | PUTSGTIXFBRIRA-XUXOKTBYSA-N |
| XLogP | 5.28 |
| TPSA | 203.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|