C22H22N4O8 — CID 91470321
2-[4-[[2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanoyl]amino]phenoxy]ethyl prop-2-enoate (PubChem CID 91470321) has the molecular formula C22H22N4O8 and a molecular weight of 470.44 g/mol. Its IUPAC name is 2-[4-[[2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanoyl]amino]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[[2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanoyl]amino]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 91470321 |
| Molecular Formula | C22H22N4O8 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[4-[[2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanoyl]amino]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(NC(=O)C(/N=N/c2ccc([N+](=O)[O-])cc2OC)C(C)=O)cc1 |
| InChI | InChI=1S/C22H22N4O8/c1-4-20(28)34-12-11-33-17-8-5-15(6-9-17)23-22(29)21(14(2)27)25-24-18-10-7-16(26(30)31)13-19(18)32-3/h4-10,13,21H,1,11-12H2,2-3H3,(H,23,29)/b25-24+ |
| InChIKey | DCBSXZVVZCHKQH-OCOZRVBESA-N |
| XLogP | 3.39 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|