C14H14N4O3 — CID 86081155
N-[(2-methoxy-4-nitrophenyl)diazenyl]-4-methylaniline (PubChem CID 86081155) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-[(2-methoxy-4-nitrophenyl)diazenyl]-4-methylaniline.
| Compound Name | N-[(2-methoxy-4-nitrophenyl)diazenyl]-4-methylaniline |
|---|---|
| PubChem CID | 86081155 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-[(2-methoxy-4-nitrophenyl)diazenyl]-4-methylaniline |
| SMILES | COc1cc([N+](=O)[O-])ccc1/N=N/Nc1ccc(C)cc1 |
| InChI | InChI=1S/C14H14N4O3/c1-10-3-5-11(6-4-10)15-17-16-13-8-7-12(18(19)20)9-14(13)21-2/h3-9H,1-2H3,(H,15,16) |
| InChIKey | VUGDTRIZERLBIT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|