C40H32N10O6 — CID 4066202
N-[2-methoxy-4-[3-methoxy-4-[[N-(4-nitroanilino)-C-phenylcarbonimidoyl]diazenyl]phenyl]phenyl]imino-N'-(4-nitroanilino)benzenecarboximidamide (PubChem CID 4066202) has the molecular formula C40H32N10O6 and a molecular weight of 748.76 g/mol. Its IUPAC name is N-[2-methoxy-4-[3-methoxy-4-[[N-(4-nitroanilino)-C-phenylcarbonimidoyl]diazenyl]phenyl]phenyl]imino-N'-(4-nitroanilino)benzenecarboximidamide.
| Compound Name | N-[2-methoxy-4-[3-methoxy-4-[[N-(4-nitroanilino)-C-phenylcarbonimidoyl]diazenyl]phenyl]phenyl]imino-N'-(4-nitroanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 4066202 |
| Molecular Formula | C40H32N10O6 |
| Molecular Weight | 748.76 g/mol |
| Exact Mass | 748.25 |
| IUPAC Name | N-[2-methoxy-4-[3-methoxy-4-[[N-(4-nitroanilino)-C-phenylcarbonimidoyl]diazenyl]phenyl]phenyl]imino-N'-(4-nitroanilino)benzenecarboximidamide |
| SMILES | COc1cc(-c2ccc(/N=N/C(=NNc3ccc([N+](=O)[O-])cc3)c3ccccc3)c(OC)c2)ccc1/N=N/C(=NNc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C40H32N10O6/c1-55-37-25-29(13-23-35(37)43-47-39(27-9-5-3-6-10-27)45-41-31-15-19-33(20-16-31)49(51)52)30-14-24-36(38(26-30)56-2)44-48-40(28-11-7-4-8-12-28)46-42-32-17-21-34(22-18-32)50(53)54/h3-26,41-42H,1-2H3/b45-39?,46-40?,47-43+,48-44+ |
| InChIKey | NHKRPSVRVUKAJC-XIKNENHQSA-N |
| XLogP | 10.30 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.76 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|