C19H22N4O6 — CID 145295180
(2-methoxy-4-nitrophenyl)diazene;N-(2-methoxyphenyl)-2-methyl-3-oxobutanamide (PubChem CID 145295180) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is (2-methoxy-4-nitrophenyl)diazene;N-(2-methoxyphenyl)-2-methyl-3-oxobutanamide.
| Compound Name | (2-methoxy-4-nitrophenyl)diazene;N-(2-methoxyphenyl)-2-methyl-3-oxobutanamide |
|---|---|
| PubChem CID | 145295180 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2-methoxy-4-nitrophenyl)diazene;N-(2-methoxyphenyl)-2-methyl-3-oxobutanamide |
| SMILES | COc1ccccc1NC(=O)C(C)C(C)=O.[H]/N=N/c1ccc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H15NO3.C7H7N3O3/c1-8(9(2)14)12(15)13-10-6-4-5-7-11(10)16-3;1-13-7-4-5(10(11)12)2-3-6(7)9-8/h4-8H,1-3H3,(H,13,15);2-4,8H,1H3/b;9-8+ |
| InChIKey | GTDQXVFCVWTCFD-RJDPJKJLSA-N |
| XLogP | 4.12 |
| TPSA | 143.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|