C17H14Cl2N4O4 — CID 57349604
N-(5-chloro-2-methylphenyl)-2-[(4-chloro-2-nitrophenyl)diazenyl]-3-oxobutanamide (PubChem CID 57349604) has the molecular formula C17H14Cl2N4O4 and a molecular weight of 409.23 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[(4-chloro-2-nitrophenyl)diazenyl]-3-oxobutanamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[(4-chloro-2-nitrophenyl)diazenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 57349604 |
| Molecular Formula | C17H14Cl2N4O4 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[(4-chloro-2-nitrophenyl)diazenyl]-3-oxobutanamide |
| SMILES | CC(=O)C(/N=N/c1ccc(Cl)cc1[N+](=O)[O-])C(=O)Nc1cc(Cl)ccc1C |
| InChI | InChI=1S/C17H14Cl2N4O4/c1-9-3-4-11(18)7-14(9)20-17(25)16(10(2)24)22-21-13-6-5-12(19)8-15(13)23(26)27/h3-8,16H,1-2H3,(H,20,25)/b22-21+ |
| InChIKey | DIXYPHBEUKYULG-QURGRASLSA-N |
| XLogP | 4.89 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|