C19H27ClN4O3 — CID 142260442
N-[2-[(4-chloro-2-nitrophenyl)diazenyl]ethyl]-2,4-dimethylaniline;ethane;methanol (PubChem CID 142260442) has the molecular formula C19H27ClN4O3 and a molecular weight of 394.90 g/mol. Its IUPAC name is N-[2-[(4-chloro-2-nitrophenyl)diazenyl]ethyl]-2,4-dimethylaniline;ethane;methanol.
| Compound Name | N-[2-[(4-chloro-2-nitrophenyl)diazenyl]ethyl]-2,4-dimethylaniline;ethane;methanol |
|---|---|
| PubChem CID | 142260442 |
| Molecular Formula | C19H27ClN4O3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[2-[(4-chloro-2-nitrophenyl)diazenyl]ethyl]-2,4-dimethylaniline;ethane;methanol |
| SMILES | CC.CO.Cc1ccc(NCC/N=N/c2ccc(Cl)cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C16H17ClN4O2.C2H6.CH4O/c1-11-3-5-14(12(2)9-11)18-7-8-19-20-15-6-4-13(17)10-16(15)21(22)23;2*1-2/h3-6,9-10,18H,7-8H2,1-2H3;1-2H3;2H,1H3/b20-19+;; |
| InChIKey | PDCHYAURYMRHTN-LLIZZRELSA-N |
| XLogP | 5.70 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|