C34H26Cl2N6O8 — CID 102145337
2-[[2-[[4-[4-[[1-(2-carboxyanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxobutanoyl]amino]benzoic acid (PubChem CID 102145337) has the molecular formula C34H26Cl2N6O8 and a molecular weight of 717.52 g/mol. Its IUPAC name is 2-[[2-[[4-[4-[[1-(2-carboxyanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxobutanoyl]amino]benzoic acid.
| Compound Name | 2-[[2-[[4-[4-[[1-(2-carboxyanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 102145337 |
| Molecular Formula | C34H26Cl2N6O8 |
| Molecular Weight | 717.52 g/mol |
| Exact Mass | 716.12 |
| IUPAC Name | 2-[[2-[[4-[4-[[1-(2-carboxyanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxobutanoyl]amino]benzoic acid |
| SMILES | CC(=O)C(/N=N/c1ccc(-c2ccc(/N=N/C(C(C)=O)C(=O)Nc3ccccc3C(=O)O)c(Cl)c2)cc1Cl)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C34H26Cl2N6O8/c1-17(43)29(31(45)37-25-9-5-3-7-21(25)33(47)48)41-39-27-13-11-19(15-23(27)35)20-12-14-28(24(36)16-20)40-42-30(18(2)44)32(46)38-26-10-6-4-8-22(26)34(49)50/h3-16,29-30H,1-2H3,(H,37,45)(H,38,46)(H,47,48)(H,49,50)/b41-39+,42-40+ |
| InChIKey | VUKLSYDQLFCHBN-LMXNTIJMSA-N |
| XLogP | 7.42 |
| TPSA | 216.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.52 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|