C38H39Cl2N7O4 — CID 20642843
2-[[4-[4-[[1-(N-amino-2,4,5-trimethylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxo-N-(2,4,5-trimethylphenyl)butanamide (PubChem CID 20642843) has the molecular formula C38H39Cl2N7O4 and a molecular weight of 728.68 g/mol. Its IUPAC name is 2-[[4-[4-[[1-(N-amino-2,4,5-trimethylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxo-N-(2,4,5-trimethylphenyl)butanamide.
| Compound Name | 2-[[4-[4-[[1-(N-amino-2,4,5-trimethylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxo-N-(2,4,5-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 20642843 |
| Molecular Formula | C38H39Cl2N7O4 |
| Molecular Weight | 728.68 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | 2-[[4-[4-[[1-(N-amino-2,4,5-trimethylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxo-N-(2,4,5-trimethylphenyl)butanamide |
| SMILES | CC(=O)C(/N=N/c1ccc(-c2ccc(/N=N/C(C(C)=O)C(=O)N(N)c3cc(C)c(C)cc3C)c(Cl)c2)cc1Cl)C(=O)Nc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C38H39Cl2N7O4/c1-19-13-23(5)33(15-21(19)3)42-37(50)35(25(7)48)45-43-31-11-9-27(17-29(31)39)28-10-12-32(30(40)18-28)44-46-36(26(8)49)38(51)47(41)34-16-22(4)20(2)14-24(34)6/h9-18,35-36H,41H2,1-8H3,(H,42,50)/b45-43+,46-44+ |
| InChIKey | MNADRFLSUMXHLT-MWOVFPFUSA-N |
| XLogP | 9.14 |
| TPSA | 159.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.68 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|