C34H30Cl2N6O4 — CID 124673872
(2S)-2-[[2-chloro-4-[3-chloro-4-[[(2R)-1-(2,4-dimethylanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-3-oxo-N-phenylbutanamide (PubChem CID 124673872) has the molecular formula C34H30Cl2N6O4 and a molecular weight of 657.56 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-4-[3-chloro-4-[[(2R)-1-(2,4-dimethylanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-3-oxo-N-phenylbutanamide.
| Compound Name | (2S)-2-[[2-chloro-4-[3-chloro-4-[[(2R)-1-(2,4-dimethylanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 124673872 |
| Molecular Formula | C34H30Cl2N6O4 |
| Molecular Weight | 657.56 g/mol |
| Exact Mass | 656.17 |
| IUPAC Name | (2S)-2-[[2-chloro-4-[3-chloro-4-[[(2R)-1-(2,4-dimethylanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-3-oxo-N-phenylbutanamide |
| SMILES | CC(=O)[C@@H](/N=N/c1ccc(-c2ccc(/N=N/[C@@H](C(C)=O)C(=O)Nc3ccccc3)c(Cl)c2)cc1Cl)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C34H30Cl2N6O4/c1-19-10-13-28(20(2)16-19)38-34(46)32(22(4)44)42-40-30-15-12-24(18-27(30)36)23-11-14-29(26(35)17-23)39-41-31(21(3)43)33(45)37-25-8-6-5-7-9-25/h5-18,31-32H,1-4H3,(H,37,45)(H,38,46)/b41-39+,42-40+/t31-,32+/m0/s1 |
| InChIKey | MKRODNLHLSBLDO-PUKSSGANSA-N |
| XLogP | 8.64 |
| TPSA | 141.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.56 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|