C33H26Cl2N6O7 — CID 170842151
5-[[2-[[4-[4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxobutanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 170842151) has the molecular formula C33H26Cl2N6O7 and a molecular weight of 689.51 g/mol. Its IUPAC name is 5-[[2-[[4-[4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxobutanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[[4-[4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxobutanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 170842151 |
| Molecular Formula | C33H26Cl2N6O7 |
| Molecular Weight | 689.51 g/mol |
| Exact Mass | 688.12 |
| IUPAC Name | 5-[[2-[[4-[4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]-3-chlorophenyl]-2-chlorophenyl]diazenyl]-3-oxobutanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | CC(=O)C(/N=N/c1ccc(-c2ccc(/N=N/C(C(C)=O)C(=O)Nc3ccc(O)c(C(=O)O)c3)c(Cl)c2)cc1Cl)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C33H26Cl2N6O7/c1-17(42)29(31(45)36-21-6-4-3-5-7-21)40-38-26-11-8-19(14-24(26)34)20-9-12-27(25(35)15-20)39-41-30(18(2)43)32(46)37-22-10-13-28(44)23(16-22)33(47)48/h3-16,29-30,44H,1-2H3,(H,36,45)(H,37,46)(H,47,48)/b40-38+,41-39+ |
| InChIKey | LLYBWXHHKDYKCU-QYGUTFKISA-N |
| XLogP | 7.42 |
| TPSA | 199.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.51 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|