C17H15N3O4 — CID 87187557
4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid (PubChem CID 87187557) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid.
| Compound Name | 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 87187557 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid |
| SMILES | CC(=O)C(/N=N/c1ccc(C(=O)O)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H15N3O4/c1-11(21)15(16(22)18-13-5-3-2-4-6-13)20-19-14-9-7-12(8-10-14)17(23)24/h2-10,15H,1H3,(H,18,22)(H,23,24)/b20-19+ |
| InChIKey | BWKJXBKXGCGSPT-FMQUCBEESA-N |
| XLogP | 3.06 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|