4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid

C17H15N3O4 — CID 87187557

IUPAC4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid
SMILESCC(=O)C(/N=N/c1ccc(C(=O)O)cc1)C(=O)Nc1ccccc1
InChIInChI=1S/C17H15N3O4/c1-11(21)15(16(22)18-13-5-3-2-4-6-13)20-19-14-9-7-12(8-10-14)17(23)24/h2-10,15H,1H3,(H,18,22)(H,23,24)/b20-19+
InChIKeyBWKJXBKXGCGSPT-FMQUCBEESA-N
MW325.32 g/mol
LogP3.06
Rot. Bonds6

About 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid

4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid (PubChem CID 87187557) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid.

Molecular Properties

Compound Name4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid
PubChem CID87187557
Molecular FormulaC17H15N3O4
Molecular Weight325.32 g/mol
Exact Mass325.11
IUPAC Name4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid
SMILESCC(=O)C(/N=N/c1ccc(C(=O)O)cc1)C(=O)Nc1ccccc1
InChIInChI=1S/C17H15N3O4/c1-11(21)15(16(22)18-13-5-3-2-4-6-13)20-19-14-9-7-12(8-10-14)17(23)24/h2-10,15H,1H3,(H,18,22)(H,23,24)/b20-19+
InChIKeyBWKJXBKXGCGSPT-FMQUCBEESA-N
XLogP3.06
TPSA108.19 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.32
LogP ≤ 53.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}

Analyze 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid?
The IUPAC name of 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid (CID 87187557) is 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid.
What is the SMILES notation for 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid?
The canonical SMILES for 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid is CC(=O)C(/N=N/c1ccc(C(=O)O)cc1)C(=O)Nc1ccccc1.
What is the InChIKey of 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid?
The InChIKey is BWKJXBKXGCGSPT-FMQUCBEESA-N. The full InChI is InChI=1S/C17H15N3O4/c1-11(21)15(16(22)18-13-5-3-2-4-6-13)20-19-14-9-7-12(8-10-14)17(23)24/h2-10,15H,1H3,(H,18,22)(H,23,24)/b20-19+.
What are the key properties of 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid?
4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid has a molecular weight of 325.32 g/mol, XLogP of 3.06, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-anilino-1,3-dioxobutan-2-yl)diazenyl]benzoic acid is sourced from PubChem (CID 87187557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).