C16H15ClN4O4S — CID 98517907
(2S)-N-(4-chlorophenyl)-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanamide (PubChem CID 98517907) has the molecular formula C16H15ClN4O4S and a molecular weight of 394.84 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanamide |
|---|---|
| PubChem CID | 98517907 |
| Molecular Formula | C16H15ClN4O4S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanamide |
| SMILES | CC(=O)[C@H](/N=N/c1ccc(S(N)(=O)=O)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN4O4S/c1-10(22)15(16(23)19-12-4-2-11(17)3-5-12)21-20-13-6-8-14(9-7-13)26(18,24)25/h2-9,15H,1H3,(H,19,23)(H2,18,24,25)/b21-20+/t15-/m0/s1 |
| InChIKey | QZGQOBLEGFRIGY-IWKHNONTSA-N |
| XLogP | 2.67 |
| TPSA | 131.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|