C17H21ClN3O3S+ — CID 2657461
(4-chlorophenyl)methyl-methyl-[(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl]azanium (PubChem CID 2657461) has the molecular formula C17H21ClN3O3S+ and a molecular weight of 382.89 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-methyl-[(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl]azanium.
| Compound Name | (4-chlorophenyl)methyl-methyl-[(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 2657461 |
| Molecular Formula | C17H21ClN3O3S+ |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (4-chlorophenyl)methyl-methyl-[(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl]azanium |
| SMILES | C[C@@H](C(=O)Nc1ccc(S(N)(=O)=O)cc1)[NH+](C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClN3O3S/c1-12(21(2)11-13-3-5-14(18)6-4-13)17(22)20-15-7-9-16(10-8-15)25(19,23)24/h3-10,12H,11H2,1-2H3,(H,20,22)(H2,19,23,24)/p+1/t12-/m0/s1 |
| InChIKey | ZTPIRWHRNHTPBU-LBPRGKRZSA-O |
| XLogP | 1.03 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |