C20H18N4O4S — CID 98517780
(2R)-N-naphthalen-1-yl-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanamide (PubChem CID 98517780) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is (2R)-N-naphthalen-1-yl-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanamide.
| Compound Name | (2R)-N-naphthalen-1-yl-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanamide |
|---|---|
| PubChem CID | 98517780 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2R)-N-naphthalen-1-yl-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanamide |
| SMILES | CC(=O)[C@@H](/N=N/c1ccc(S(N)(=O)=O)cc1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C20H18N4O4S/c1-13(25)19(24-23-15-9-11-16(12-10-15)29(21,27)28)20(26)22-18-8-4-6-14-5-2-3-7-17(14)18/h2-12,19H,1H3,(H,22,26)(H2,21,27,28)/b24-23+/t19-/m1/s1 |
| InChIKey | IEADFHIYHFNJGI-FYTMPNSFSA-N |
| XLogP | 3.17 |
| TPSA | 131.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|