C21H30N4O4 — CID 90704054
ethane;nitromethane;3-oxo-N-phenyl-2-phenyldiazenylbutanamide (PubChem CID 90704054) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is ethane;nitromethane;3-oxo-N-phenyl-2-phenyldiazenylbutanamide.
| Compound Name | ethane;nitromethane;3-oxo-N-phenyl-2-phenyldiazenylbutanamide |
|---|---|
| PubChem CID | 90704054 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | ethane;nitromethane;3-oxo-N-phenyl-2-phenyldiazenylbutanamide |
| SMILES | CC.CC.CC(=O)C(/N=N/c1ccccc1)C(=O)Nc1ccccc1.C[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N3O2.2C2H6.CH3NO2/c1-12(20)15(19-18-14-10-6-3-7-11-14)16(21)17-13-8-4-2-5-9-13;2*1-2;1-2(3)4/h2-11,15H,1H3,(H,17,21);2*1-2H3;1H3/b19-18+;;; |
| InChIKey | OLQQKKKBDCTLDR-HRBIVCMLSA-N |
| XLogP | 5.31 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|