C18H15ClN6O4S2 — CID 98517861
(2S)-N-(4-chlorophenyl)-3-oxo-2-[[4-(1,3,4-thiadiazol-2-ylsulfamoyl)phenyl]diazenyl]butanamide (PubChem CID 98517861) has the molecular formula C18H15ClN6O4S2 and a molecular weight of 478.94 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-3-oxo-2-[[4-(1,3,4-thiadiazol-2-ylsulfamoyl)phenyl]diazenyl]butanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-3-oxo-2-[[4-(1,3,4-thiadiazol-2-ylsulfamoyl)phenyl]diazenyl]butanamide |
|---|---|
| PubChem CID | 98517861 |
| Molecular Formula | C18H15ClN6O4S2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-3-oxo-2-[[4-(1,3,4-thiadiazol-2-ylsulfamoyl)phenyl]diazenyl]butanamide |
| SMILES | CC(=O)[C@H](/N=N/c1ccc(S(=O)(=O)Nc2nncs2)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN6O4S2/c1-11(26)16(17(27)21-13-4-2-12(19)3-5-13)23-22-14-6-8-15(9-7-14)31(28,29)25-18-24-20-10-30-18/h2-10,16H,1H3,(H,21,27)(H,24,25)/b23-22+/t16-/m0/s1 |
| InChIKey | YKCSTRUIMLEQPE-LSJZCYCUSA-N |
| XLogP | 3.67 |
| TPSA | 142.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|