C18H26N4O3S2 — CID 70960231
2-methyl-N-[4-(1,3,4-thiadiazol-2-ylsulfamoyl)phenyl]nonanamide (PubChem CID 70960231) has the molecular formula C18H26N4O3S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 2-methyl-N-[4-(1,3,4-thiadiazol-2-ylsulfamoyl)phenyl]nonanamide.
| Compound Name | 2-methyl-N-[4-(1,3,4-thiadiazol-2-ylsulfamoyl)phenyl]nonanamide |
|---|---|
| PubChem CID | 70960231 |
| Molecular Formula | C18H26N4O3S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-methyl-N-[4-(1,3,4-thiadiazol-2-ylsulfamoyl)phenyl]nonanamide |
| SMILES | CCCCCCCC(C)C(=O)Nc1ccc(S(=O)(=O)Nc2nncs2)cc1 |
| InChI | InChI=1S/C18H26N4O3S2/c1-3-4-5-6-7-8-14(2)17(23)20-15-9-11-16(12-10-15)27(24,25)22-18-21-19-13-26-18/h9-14H,3-8H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | BQIARVWNTSSHCO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|