C36H33Cl3N6O6 — CID 99650348
(2R)-2-[[2-chloro-4-[3-chloro-4-[[(2R)-1-(4-chloro-2,5-dimethoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide (PubChem CID 99650348) has the molecular formula C36H33Cl3N6O6 and a molecular weight of 752.05 g/mol. Its IUPAC name is (2R)-2-[[2-chloro-4-[3-chloro-4-[[(2R)-1-(4-chloro-2,5-dimethoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide.
| Compound Name | (2R)-2-[[2-chloro-4-[3-chloro-4-[[(2R)-1-(4-chloro-2,5-dimethoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 99650348 |
| Molecular Formula | C36H33Cl3N6O6 |
| Molecular Weight | 752.05 g/mol |
| Exact Mass | 750.15 |
| IUPAC Name | (2R)-2-[[2-chloro-4-[3-chloro-4-[[(2R)-1-(4-chloro-2,5-dimethoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide |
| SMILES | COc1cc(NC(=O)[C@H](/N=N/c2ccc(-c3ccc(/N=N/[C@H](C(C)=O)C(=O)Nc4ccc(C)cc4C)c(Cl)c3)cc2Cl)C(C)=O)c(OC)cc1Cl |
| InChI | InChI=1S/C36H33Cl3N6O6/c1-18-7-10-27(19(2)13-18)40-35(48)33(20(3)46)44-42-28-11-8-22(14-24(28)37)23-9-12-29(25(38)15-23)43-45-34(21(4)47)36(49)41-30-17-31(50-5)26(39)16-32(30)51-6/h7-17,33-34H,1-6H3,(H,40,48)(H,41,49)/b44-42+,45-43+/t33-,34-/m1/s1 |
| InChIKey | CTCGHGAGCLXAHB-UZTGCPOJSA-N |
| XLogP | 9.31 |
| TPSA | 160.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.05 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|